CAS 65165-91-5 appears in our catalog under these names: D-Folic Acid, Folic Acid Impurity 10, D-Folic Acid, 95%, 95%, (4-(((2-Amino-4-oxo-3,4-dihydropteridin-6-yl)methyl)amino)benzoyl)-d-glutamic acid, 98%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Chemat, Fluorochem. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(2R)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid (CAS 65165-91-5) is a chemical compound with the molecular formula C19H19N7O6 and a molecular weight of 441.4 g/mol. IUPAC name: (2R)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid. InChIKey: OVBPIULPVIDEAO-GFCCVEGCSA-N.
| Molecular formula | C19H19N7O6 |
|---|---|
| Molecular weight | 441.4 g/mol |
| IUPAC name | (2R)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid |
| InChIKey | OVBPIULPVIDEAO-GFCCVEGCSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N[C@H](CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N |
Computed by PubChem (NCBI)