CAS 69022-87-3 appears in our catalog under these names: Folic Acid-d2, Folic Acid-d2, >95% (HPLC), Folic Acid–d2, Folic acid-d2, 97.86%. Offered by: Hubei YoungXin, TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 1mg, 5 mg.
(2S)-2-[[4-[[(2-amino-4-oxo-3H-pteridin-6-yl)-dideuteriomethyl]amino]benzoyl]amino]pentanedioic acid (CAS 69022-87-3) is a chemical compound with the molecular formula C19H19N7O6 and a molecular weight of 443.4 g/mol. IUPAC name: (2S)-2-[[4-[[(2-amino-4-oxo-3H-pteridin-6-yl)-dideuteriomethyl]amino]benzoyl]amino]pentanedioic acid. InChIKey: OVBPIULPVIDEAO-AJEQZRFCSA-N.
| Molecular formula | C19H19N7O6 |
|---|---|
| Molecular weight | 443.4 g/mol |
| IUPAC name | (2S)-2-[[4-[[(2-amino-4-oxo-3H-pteridin-6-yl)-dideuteriomethyl]amino]benzoyl]amino]pentanedioic acid |
| InChIKey | OVBPIULPVIDEAO-AJEQZRFCSA-N |
| SMILES | [2H]C([2H])(C1=CN=C2C(=N1)C(=O)NC(=N2)N)NC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)