Products 1207283-55-3
CAS 1207283-55-3 is the registry number for Phenyl 3-fluoro-6-hydroxy-2-methylbenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Phenyl 3-fluoro-6-hydroxy-2-methylbenzoate (CAS 1207283-55-3) is a chemical compound with the molecular formula C14H11FO3 and a molecular weight of 246.23 g/mol. IUPAC name: phenyl 3-fluoro-6-hydroxy-2-methylbenzoate. InChIKey: WCJBQCKZTRUDDM-UHFFFAOYSA-N.
| Molecular formula | C14H11FO3 |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | phenyl 3-fluoro-6-hydroxy-2-methylbenzoate |
| InChIKey | WCJBQCKZTRUDDM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C(=O)OC2=CC=CC=C2)O)F |
Computed by PubChem (NCBI)