CAS 120757-13-3 appears in our catalog under these names: 4-(4-Aminophenyl)-3-methyl-4-oxobutanoic acid hydrochloride, 95%, 4-(4-Aminophenyl)-3-methyl-4-oxobutanoic acid hydrochloride, 4-(4-Aminophenyl)-3-methyl-4-oxobutanoic acid hydrochloride, 95+%, 95+%, 4-(4-AMINOPHENYL)-3-METHYL-4-OXOBUTANOIC ACID HCL, 95+%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50g, 25g, 5g, 10g.
4-(4-aminophenyl)-3-methyl-4-oxobutanoic acid;hydrochloride (CAS 120757-13-3) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: 4-(4-aminophenyl)-3-methyl-4-oxobutanoic acid;hydrochloride. InChIKey: TWOMUAFJJQQOJK-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | 4-(4-aminophenyl)-3-methyl-4-oxobutanoic acid;hydrochloride |
| InChIKey | TWOMUAFJJQQOJK-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)C(=O)C1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)