Products 1207754-80-0
CAS 1207754-80-0 is the registry number for (R)-2-(tert-Butyl)-2-methyl-1-tosylaziridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-tert-butyl-2-methyl-1-(4-methylphenyl)sulfonylaziridine (CAS 1207754-80-0) is a chemical compound with the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. IUPAC name: (2R)-2-tert-butyl-2-methyl-1-(4-methylphenyl)sulfonylaziridine. InChIKey: OKKPTYPQFAFGOT-MLCCFXAWSA-N.
| Molecular formula | C14H21NO2S |
|---|---|
| Molecular weight | 267.39 g/mol |
| IUPAC name | (2R)-2-tert-butyl-2-methyl-1-(4-methylphenyl)sulfonylaziridine |
| InChIKey | OKKPTYPQFAFGOT-MLCCFXAWSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C[C@@]2(C)C(C)(C)C |
Computed by PubChem (NCBI)