CAS 1207853-07-3 is the registry number for Benzyl rel-(3R,4S)-3-amino-4-fluoropiperidine-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Benzyl (3R,4S)-3-amino-4-fluoropiperidine-1-carboxylate (CAS 1207853-07-3) is a chemical compound with the molecular formula C13H17FN2O2 and a molecular weight of 252.28 g/mol. IUPAC name: benzyl (3R,4S)-3-amino-4-fluoropiperidine-1-carboxylate. InChIKey: JREMPGXODKGFEJ-NWDGAFQWSA-N.
| Molecular formula | C13H17FN2O2 |
|---|---|
| Molecular weight | 252.28 g/mol |
| IUPAC name | benzyl (3R,4S)-3-amino-4-fluoropiperidine-1-carboxylate |
| InChIKey | JREMPGXODKGFEJ-NWDGAFQWSA-N |
| SMILES | C1CN(C[C@H]([C@H]1F)N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)