CAS 1792190-53-4 is the registry number for Benzyl (3S,4S)-3-amino-4-fluoropiperidine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (3S,4S)-3-amino-4-fluoropiperidine-1-carboxylate (CAS 1792190-53-4) is a chemical compound with the molecular formula C13H17FN2O2 and a molecular weight of 252.28 g/mol. IUPAC name: benzyl (3S,4S)-3-amino-4-fluoropiperidine-1-carboxylate. InChIKey: JREMPGXODKGFEJ-RYUDHWBXSA-N.
| Molecular formula | C13H17FN2O2 |
|---|---|
| Molecular weight | 252.28 g/mol |
| IUPAC name | benzyl (3S,4S)-3-amino-4-fluoropiperidine-1-carboxylate |
| InChIKey | JREMPGXODKGFEJ-RYUDHWBXSA-N |
| SMILES | C1CN(C[C@@H]([C@H]1F)N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)