Products 902836-92-4
CAS 902836-92-4 is the registry number for 2-Chloro-4-(3-piperidinyloxy)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-4-piperidin-3-yloxybenzonitrile (CAS 902836-92-4) is a chemical compound with the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. IUPAC name: 2-chloro-4-piperidin-3-yloxybenzonitrile. InChIKey: GPGZXKBRTANYCD-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O |
|---|---|
| Molecular weight | 236.70 g/mol |
| IUPAC name | 2-chloro-4-piperidin-3-yloxybenzonitrile |
| InChIKey | GPGZXKBRTANYCD-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)OC2=CC(=C(C=C2)C#N)Cl |
Computed by PubChem (NCBI)