CAS 120800-52-4 appears in our catalog under these names: 6-Morpholinonicotinic acid, 98%, 6-Morpholinonicotinic acid, 6-Morpholinonicotinic acid, 95% , 6-Morpholinonicotinic acid 98%, 6-MORPHOLINONICOTINIC ACID, 98%, 98%. Offered by: Combi-blocks, Biosynth, Thermo Scientific, Ambeed, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250MG.
6-morpholin-4-ylpyridine-3-carboxylic acid (CAS 120800-52-4) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 6-morpholin-4-ylpyridine-3-carboxylic acid. InChIKey: XXDSDFLDYNISKD-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 6-morpholin-4-ylpyridine-3-carboxylic acid |
| InChIKey | XXDSDFLDYNISKD-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)