Products 1208075-10-8
CAS 1208075-10-8 is the registry number for 4-Bromo-2-(trifluoromethyl)benzenethiol. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-bromo-2-(trifluoromethyl)benzenethiol (CAS 1208075-10-8) is a chemical compound with the molecular formula C7H4BrF3S and a molecular weight of 257.07 g/mol. IUPAC name: 4-bromo-2-(trifluoromethyl)benzenethiol. InChIKey: XBPGBNVNPXUGPS-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3S |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 4-bromo-2-(trifluoromethyl)benzenethiol |
| InChIKey | XBPGBNVNPXUGPS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(F)(F)F)S |
Computed by PubChem (NCBI)