CAS 59594-65-9 appears in our catalog under these names: 2-Bromo-4-(trifluoromethyl)benzenethiol, 97%, 2-Bromo-4-trifluoromethylbenzenethiol, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
2-bromo-4-(trifluoromethyl)benzenethiol (CAS 59594-65-9) is a chemical compound with the molecular formula C7H4BrF3S and a molecular weight of 257.07 g/mol. IUPAC name: 2-bromo-4-(trifluoromethyl)benzenethiol. InChIKey: GTBJPCSVDHUDFU-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3S |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethyl)benzenethiol |
| InChIKey | GTBJPCSVDHUDFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)S |
Computed by PubChem (NCBI)