CAS 2252-45-1 is the registry number for 3-Bromophenyl trifluoromethyl sulfide, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
1-bromo-3-(trifluoromethylsulfanyl)benzene (CAS 2252-45-1) is a chemical compound with the molecular formula C7H4BrF3S and a molecular weight of 257.07 g/mol. IUPAC name: 1-bromo-3-(trifluoromethylsulfanyl)benzene. InChIKey: OLHXBVBNFOHXOB-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3S |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 1-bromo-3-(trifluoromethylsulfanyl)benzene |
| InChIKey | OLHXBVBNFOHXOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)SC(F)(F)F |
Computed by PubChem (NCBI)