CAS 60877-19-2 is the registry number for 2-Bromo-5-trifluoromethylbenzenethiol, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
2-bromo-5-(trifluoromethyl)benzenethiol (CAS 60877-19-2) is a chemical compound with the molecular formula C7H4BrF3S and a molecular weight of 257.07 g/mol. IUPAC name: 2-bromo-5-(trifluoromethyl)benzenethiol. InChIKey: ZXVCDJUEVOLNEV-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3S |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 2-bromo-5-(trifluoromethyl)benzenethiol |
| InChIKey | ZXVCDJUEVOLNEV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)S)Br |
Computed by PubChem (NCBI)