CAS 1208231-33-7 is the registry number for (S)-2-((tert-Butoxycarbonyl)amino)-3-fluoropropanoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(2S)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1208231-33-7) is a chemical compound with the molecular formula C8H14FNO4 and a molecular weight of 207.20 g/mol. IUPAC name: (2S)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: PQTDAIHXUZZXQM-RXMQYKEDSA-N.
| Molecular formula | C8H14FNO4 |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | (2S)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | PQTDAIHXUZZXQM-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CF)C(=O)O |
Computed by PubChem (NCBI)