CAS 294858-41-6 appears in our catalog under these names: (S)-3-((tert-Butoxycarbonyl)amino)-2-fluoropropanoic acid, 97%, Boc-beta-Ala(2-F)-OH (S), (S)-3-((tert-Butoxycarbonyl)amino)-2-fluoropropanoic acid, ≥95%, ≥95%, (S)-3-((TERT-BUTOXYCARBONYL)AMINO)-2-FLUOROPROPANOIC ACID, ≥95%. Offered by: AmBeed, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, on request, 50mg, 100mg, 250mg, 5g.
(2S)-2-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 294858-41-6) is a chemical compound with the molecular formula C8H14FNO4 and a molecular weight of 207.20 g/mol. IUPAC name: (2S)-2-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: OYUCZGVVXISNFC-YFKPBYRVSA-N.
| Molecular formula | C8H14FNO4 |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | (2S)-2-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | OYUCZGVVXISNFC-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](C(=O)O)F |
Computed by PubChem (NCBI)