CAS 76399-81-0 appears in our catalog under these names: 3-Fluoro-N-{((2-methyl-2-propanyl)oxy)carbonyl}-L-alanine, Fmoc-Ala(F)-OH 97%. Offered by: Biosynth, Ambeed. Available pack sizes: 50mg, 100mg, 25mg, 250mg, 1g.
(2R)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 76399-81-0) is a chemical compound with the molecular formula C8H14FNO4 and a molecular weight of 207.20 g/mol. IUPAC name: (2R)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: PQTDAIHXUZZXQM-YFKPBYRVSA-N.
| Molecular formula | C8H14FNO4 |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | (2R)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | PQTDAIHXUZZXQM-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CF)C(=O)O |
Computed by PubChem (NCBI)