CAS 412352-68-2 is the registry number for Boc-beta-Ala(2-F)-OH (R). Offered by: Iris Biotech. Available pack sizes: on request.
(2R)-2-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 412352-68-2) is a chemical compound with the molecular formula C8H14FNO4 and a molecular weight of 207.20 g/mol. IUPAC name: (2R)-2-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: OYUCZGVVXISNFC-RXMQYKEDSA-N.
| Molecular formula | C8H14FNO4 |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | (2R)-2-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | OYUCZGVVXISNFC-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](C(=O)O)F |
Computed by PubChem (NCBI)