Products 1208332-61-9
CAS 1208332-61-9 is the registry number for Cis-3-(4-methyl-piperazin-1-yl)-cyclohexanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Cis-(1R,3S)-3-(4-methylpiperazin-1-yl)cyclohexane-1-carboxylic acid (CAS 1208332-61-9) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: cis-(1R,3S)-3-(4-methylpiperazin-1-yl)cyclohexane-1-carboxylic acid. InChIKey: MBVYOPHPWIAIAI-MNOVXSKESA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | cis-(1R,3S)-3-(4-methylpiperazin-1-yl)cyclohexane-1-carboxylic acid |
| InChIKey | MBVYOPHPWIAIAI-MNOVXSKESA-N |
| SMILES | CN1CCN(CC1)[C@H]2CCC[C@H](C2)C(=O)O |
Computed by PubChem (NCBI)