Products 1208535-51-6
CAS 1208535-51-6 is the registry number for 5-(3,5-Dimethyl-4H-1,2,4-Triazol-4-Yl)-1,3-Benzenedicarboxylic Acid, 95%. Offered by: Chemat. Available pack sizes: 100mg.
5-(3,5-dimethyl-1,2,4-triazol-4-yl)benzene-1,3-dicarboxylic acid (CAS 1208535-51-6) is a chemical compound with the molecular formula C12H11N3O4 and a molecular weight of 261.23 g/mol. IUPAC name: 5-(3,5-dimethyl-1,2,4-triazol-4-yl)benzene-1,3-dicarboxylic acid. InChIKey: POLCUQJDWZCTCL-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O4 |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | 5-(3,5-dimethyl-1,2,4-triazol-4-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | POLCUQJDWZCTCL-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N1C2=CC(=CC(=C2)C(=O)O)C(=O)O)C |
Computed by PubChem (NCBI)