CAS 1208672-46-1 is the registry number for 5-Isothiocyanato-2-(trifluoromethyl)pyridine, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 1g, 5g.
5-isothiocyanato-2-(trifluoromethyl)pyridine (CAS 1208672-46-1) is a chemical compound with the molecular formula C7H3F3N2S and a molecular weight of 204.17 g/mol. IUPAC name: 5-isothiocyanato-2-(trifluoromethyl)pyridine. InChIKey: NEGJIUNBOBNOHZ-UHFFFAOYSA-N.
| Molecular formula | C7H3F3N2S |
|---|---|
| Molecular weight | 204.17 g/mol |
| IUPAC name | 5-isothiocyanato-2-(trifluoromethyl)pyridine |
| InChIKey | NEGJIUNBOBNOHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1N=C=S)C(F)(F)F |
Computed by PubChem (NCBI)