CAS 17754-05-1 appears in our catalog under these names: 5-(Trifluoromethyl)benzo[c][1,2,5]thiadiazole, 95%, 5-(Trifluoromethyl)benzo-[2,1,3]-thiadiazole, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 1g, 5g.
5-(trifluoromethyl)-2,1,3-benzothiadiazole (CAS 17754-05-1) is a chemical compound with the molecular formula C7H3F3N2S and a molecular weight of 204.17 g/mol. IUPAC name: 5-(trifluoromethyl)-2,1,3-benzothiadiazole. InChIKey: KUFWKXPZEWUROO-UHFFFAOYSA-N.
| Molecular formula | C7H3F3N2S |
|---|---|
| Molecular weight | 204.17 g/mol |
| IUPAC name | 5-(trifluoromethyl)-2,1,3-benzothiadiazole |
| InChIKey | KUFWKXPZEWUROO-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C=C1C(F)(F)F |
Computed by PubChem (NCBI)