CAS 328037-32-7 is the registry number for 2-Amino-4,5,6-trifluorobenzothiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
4,5,6-trifluoro-1,3-benzothiazol-2-amine (CAS 328037-32-7) is a chemical compound with the molecular formula C7H3F3N2S and a molecular weight of 204.17 g/mol. IUPAC name: 4,5,6-trifluoro-1,3-benzothiazol-2-amine. InChIKey: FKOMJCFVDCQUNY-UHFFFAOYSA-N.
| Molecular formula | C7H3F3N2S |
|---|---|
| Molecular weight | 204.17 g/mol |
| IUPAC name | 4,5,6-trifluoro-1,3-benzothiazol-2-amine |
| InChIKey | FKOMJCFVDCQUNY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C2=C1SC(=N2)N)F)F)F |
Computed by PubChem (NCBI)