CAS 942473-96-3 is the registry number for 5,6,7-Trifluorobenzo[d]thiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6,7-trifluoro-1,3-benzothiazol-2-amine (CAS 942473-96-3) is a chemical compound with the molecular formula C7H3F3N2S and a molecular weight of 204.17 g/mol. IUPAC name: 5,6,7-trifluoro-1,3-benzothiazol-2-amine. InChIKey: DQLAGXBUTICAIQ-UHFFFAOYSA-N.
| Molecular formula | C7H3F3N2S |
|---|---|
| Molecular weight | 204.17 g/mol |
| IUPAC name | 5,6,7-trifluoro-1,3-benzothiazol-2-amine |
| InChIKey | DQLAGXBUTICAIQ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1F)F)F)SC(=N2)N |
Computed by PubChem (NCBI)