CAS 1209067-87-7 is the registry number for 2-Fluoro-5-pivalamidobenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,2-dimethylpropanoylamino)-2-fluorobenzamide (CAS 1209067-87-7) is a chemical compound with the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. IUPAC name: 5-(2,2-dimethylpropanoylamino)-2-fluorobenzamide. InChIKey: RPVKPLKWZJSXBU-UHFFFAOYSA-N.
| Molecular formula | C12H15FN2O2 |
|---|---|
| Molecular weight | 238.26 g/mol |
| IUPAC name | 5-(2,2-dimethylpropanoylamino)-2-fluorobenzamide |
| InChIKey | RPVKPLKWZJSXBU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=C(C=C1)F)C(=O)N |
Computed by PubChem (NCBI)