CAS 2250241-96-2 appears in our catalog under these names: (1S)-7-Chloro-1,2,3,4-tetrahydronaphthylamine hydrochloride, 95%, (S)-7-Chloro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 97%, 97%, (S)-7-Chloro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
(1S)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 2250241-96-2) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: (1S)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: QXILHQTXJHTACC-PPHPATTJSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | (1S)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | QXILHQTXJHTACC-PPHPATTJSA-N |
| SMILES | C1C[C@@H](C2=C(C1)C=CC(=C2)Cl)N.Cl |
Computed by PubChem (NCBI)