Products 1209685-75-5
CAS 1209685-75-5 appears in our catalog under these names: (1-(4-(Trifluoromethoxy)phenyl)cyclopropyl)methanamine hydrochloride, 95%, (1-(4-(Trifluoromethoxy)phenyl)cyclopropyl)methanamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 2,5g.
[1-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine;hydrochloride (CAS 1209685-75-5) is a chemical compound with the molecular formula C11H13ClF3NO and a molecular weight of 267.67 g/mol. IUPAC name: [1-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine;hydrochloride. InChIKey: BDOZXLHIVFHDKW-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3NO |
|---|---|
| Molecular weight | 267.67 g/mol |
| IUPAC name | [1-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine;hydrochloride |
| InChIKey | BDOZXLHIVFHDKW-UHFFFAOYSA-N |
| SMILES | C1CC1(CN)C2=CC=C(C=C2)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)