Products 1357946-25-8
CAS 1357946-25-8 appears in our catalog under these names: 2-(4-(Trifluoromethyl)phenyl)morpholine hydrochloride, 95%, 2-(4-(Trifluoromethyl)phenyl)morpholine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
2-[4-(trifluoromethyl)phenyl]morpholine;hydrochloride (CAS 1357946-25-8) is a chemical compound with the molecular formula C11H13ClF3NO and a molecular weight of 267.67 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]morpholine;hydrochloride. InChIKey: JPBHKTZRFJSFKT-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3NO |
|---|---|
| Molecular weight | 267.67 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]morpholine;hydrochloride |
| InChIKey | JPBHKTZRFJSFKT-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=CC=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)