CAS 2490698-37-6 appears in our catalog under these names: 1-[6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine hydrochloride (1:1), 95%, (6-(Trifluoromethyl)chroman-4-yl)methanamine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
[6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine;hydrochloride (CAS 2490698-37-6) is a chemical compound with the molecular formula C11H13ClF3NO and a molecular weight of 267.67 g/mol. IUPAC name: [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine;hydrochloride. InChIKey: UKTGPKIJRSWRKI-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3NO |
|---|---|
| Molecular weight | 267.67 g/mol |
| IUPAC name | [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]methanamine;hydrochloride |
| InChIKey | UKTGPKIJRSWRKI-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1CN)C=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)