CAS 1380279-81-1 is the registry number for Cyclobutanamine, 3-(4-trifluoromethylphenoxy)-, hydrochloride (1:1), trans-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[4-(trifluoromethyl)phenoxy]cyclobutan-1-amine;hydrochloride (CAS 1380279-81-1) is a chemical compound with the molecular formula C11H13ClF3NO and a molecular weight of 267.67 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenoxy]cyclobutan-1-amine;hydrochloride. InChIKey: VRBFCSSQODQQPE-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3NO |
|---|---|
| Molecular weight | 267.67 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenoxy]cyclobutan-1-amine;hydrochloride |
| InChIKey | VRBFCSSQODQQPE-UHFFFAOYSA-N |
| SMILES | C1C(CC1OC2=CC=C(C=C2)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)