CAS 120972-66-9 appears in our catalog under these names: 2-(4-Aminophenyl)isoindolin-1-one, 95%, 2-(4-Aminophenyl)isoindolin-1-one 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
2-(4-aminophenyl)-3H-isoindol-1-one (CAS 120972-66-9) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 2-(4-aminophenyl)-3H-isoindol-1-one. InChIKey: XMNGQYWDALZQMI-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 2-(4-aminophenyl)-3H-isoindol-1-one |
| InChIKey | XMNGQYWDALZQMI-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)N1C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)