CAS 121-61-9 appears in our catalog under these names: p-Sulfamylacetanilide, p-Sulfamylacetanilide, >95% (HPLC), 4–Acetamidobenzenesulfonamide, 4-Acetamidobenzenesulfonamide/ 99.99%, 4-Acetamidobenzenesulfonamide. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: on request, 10g, 500mg, 5g, 100mg, 10mM (in 1ml dmso), 200mg, 500g.
N-(4-sulfamoylphenyl)acetamide (CAS 121-61-9) is a chemical compound with the molecular formula C8H10N2O3S and a molecular weight of 214.24 g/mol. IUPAC name: N-(4-sulfamoylphenyl)acetamide. InChIKey: PKOFBDHYTMYVGJ-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | N-(4-sulfamoylphenyl)acetamide |
| InChIKey | PKOFBDHYTMYVGJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)N |
Computed by PubChem (NCBI)