Products 90007-59-3
CAS 90007-59-3 appears in our catalog under these names: 3-(Thiophen-2-yl)-3-ureidopropanoic acid, 95%, 3-(Carbamoylamino)-3-(thiophen-2-yl)propanoic acid, 3-(Carbamoylamino)-3-(thiophen-2-yl)propanoic acid, 95%. Offered by: AmBeed, Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 10g, 1g, 250mg.
3-(carbamoylamino)-3-thiophen-2-ylpropanoic acid (CAS 90007-59-3) is a chemical compound with the molecular formula C8H10N2O3S and a molecular weight of 214.24 g/mol. IUPAC name: 3-(carbamoylamino)-3-thiophen-2-ylpropanoic acid. InChIKey: PGIQJSFYODPBMU-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | 3-(carbamoylamino)-3-thiophen-2-ylpropanoic acid |
| InChIKey | PGIQJSFYODPBMU-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(CC(=O)O)NC(=O)N |
Computed by PubChem (NCBI)