Products 77435-45-1
CAS 77435-45-1 appears in our catalog under these names: N-Acetylsulfanilamide-d4, D4-4-Acetylsulfanilamide, D4-4-Acetylsulfanilamide, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: MedChemExpress, HPC Standards. Available pack sizes: Get quote, 1x5mg, 1x1ml.
N,2,2,2-tetradeuterio-N-(4-sulfamoylphenyl)acetamide (CAS 77435-45-1) is a chemical compound with the molecular formula C8H10N2O3S and a molecular weight of 218.27 g/mol. IUPAC name: N,2,2,2-tetradeuterio-N-(4-sulfamoylphenyl)acetamide. InChIKey: PKOFBDHYTMYVGJ-GUEYOVJQSA-N.
| Molecular formula | C8H10N2O3S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | N,2,2,2-tetradeuterio-N-(4-sulfamoylphenyl)acetamide |
| InChIKey | PKOFBDHYTMYVGJ-GUEYOVJQSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N([2H])C1=CC=C(C=C1)S(=O)(=O)N |
Computed by PubChem (NCBI)