Products 1210-84-0

CAS 1210-84-0 is the registry number for 5-(1H-Indol-3-yl)pentanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-(1H-indol-3-yl)pentanoic acid (CAS 1210-84-0) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 5-(1H-indol-3-yl)pentanoic acid. InChIKey: JYSVRMSRLUBSRO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO2
Molecular weight217.26 g/mol
IUPAC name5-(1H-indol-3-yl)pentanoic acid
InChIKeyJYSVRMSRLUBSRO-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CN2)CCCCC(=O)O

Computed by PubChem (NCBI)