CAS 1210-96-4 is the registry number for Benzene,1,5-dimethoxy-2,4-dinitro-, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
1,5-dimethoxy-2,4-dinitrobenzene (CAS 1210-96-4) is a chemical compound with the molecular formula C8H8N2O6 and a molecular weight of 228.16 g/mol. IUPAC name: 1,5-dimethoxy-2,4-dinitrobenzene. InChIKey: FNFRSLVCFFJHEE-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O6 |
|---|---|
| Molecular weight | 228.16 g/mol |
| IUPAC name | 1,5-dimethoxy-2,4-dinitrobenzene |
| InChIKey | FNFRSLVCFFJHEE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])OC |
Computed by PubChem (NCBI)