CAS 3395-03-7 appears in our catalog under these names: 1,2-Dimethoxy-4,5-dinitrobenzene, 97%, 1,2-Dimethoxy-4,5-dinitrobenzene, 1,2-Dimethoxy-4,5-dinitrobenzene, 96% , 1,2-Dimethoxy-4,5-dinitrobenzene, >98.0%(GC). Offered by: Combi-blocks, TRC, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 5g, 25g, 10g, 1g, 2,5g.
1,2-dimethoxy-4,5-dinitrobenzene (CAS 3395-03-7) is a chemical compound with the molecular formula C8H8N2O6 and a molecular weight of 228.16 g/mol. IUPAC name: 1,2-dimethoxy-4,5-dinitrobenzene. InChIKey: WFDHPWTYKOAFBJ-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O6 |
|---|---|
| Molecular weight | 228.16 g/mol |
| IUPAC name | 1,2-dimethoxy-4,5-dinitrobenzene |
| InChIKey | WFDHPWTYKOAFBJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)[N+](=O)[O-])[N+](=O)[O-])OC |
Computed by PubChem (NCBI)