Products 746608-27-5
CAS 746608-27-5 is the registry number for 3-((5-Nitrofuran-2-yl)formamido)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
3-[(5-nitrofuran-2-carbonyl)amino]propanoic acid (CAS 746608-27-5) is a chemical compound with the molecular formula C8H8N2O6 and a molecular weight of 228.16 g/mol. IUPAC name: 3-[(5-nitrofuran-2-carbonyl)amino]propanoic acid. InChIKey: UBFCXBILQZHHCN-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O6 |
|---|---|
| Molecular weight | 228.16 g/mol |
| IUPAC name | 3-[(5-nitrofuran-2-carbonyl)amino]propanoic acid |
| InChIKey | UBFCXBILQZHHCN-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])C(=O)NCCC(=O)O |
Computed by PubChem (NCBI)