CAS 2831-60-9 appears in our catalog under these names: 2–(2,4–DINITROPHENOXY)ETHANOL, 2-(2,4-Dinitrophenoxy)ethanol. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 5g, 2g, 10g, 25g.
2-(2,4-dinitrophenoxy)ethanol (CAS 2831-60-9) is a chemical compound with the molecular formula C8H8N2O6 and a molecular weight of 228.16 g/mol. IUPAC name: 2-(2,4-dinitrophenoxy)ethanol. InChIKey: YYTMNJWMYPSLOD-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O6 |
|---|---|
| Molecular weight | 228.16 g/mol |
| IUPAC name | 2-(2,4-dinitrophenoxy)ethanol |
| InChIKey | YYTMNJWMYPSLOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])OCCO |
Computed by PubChem (NCBI)