CAS 1210041-74-9 is the registry number for (1S)-2'-Amino-3,3'-dimethyl-[1,1'-binaphthalen]-2-ol 98%. Offered by: Ambeed. Available pack sizes: 10mg, 25mg, 50mg.
1-(2-amino-3-methylnaphthalen-1-yl)-3-methylnaphthalen-2-ol (CAS 1210041-74-9) is a chemical compound with the molecular formula C22H19NO and a molecular weight of 313.4 g/mol. IUPAC name: 1-(2-amino-3-methylnaphthalen-1-yl)-3-methylnaphthalen-2-ol. InChIKey: ANIBTEIZMWQMNV-UHFFFAOYSA-N.
| Molecular formula | C22H19NO |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 1-(2-amino-3-methylnaphthalen-1-yl)-3-methylnaphthalen-2-ol |
| InChIKey | ANIBTEIZMWQMNV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC=CC=C2C(=C1N)C3=C(C(=CC4=CC=CC=C43)C)O |
Computed by PubChem (NCBI)