Products 36208-62-5

CAS 36208-62-5 is the registry number for 1,3-Dibenzyl-1,3-dihydroindol-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

1,3-dibenzyl-3H-indol-2-one (CAS 36208-62-5) is a chemical compound with the molecular formula C22H19NO and a molecular weight of 313.4 g/mol. IUPAC name: 1,3-dibenzyl-3H-indol-2-one. InChIKey: WHRCBGICFPTETJ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H19NO
Molecular weight313.4 g/mol
IUPAC name1,3-dibenzyl-3H-indol-2-one
InChIKeyWHRCBGICFPTETJ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC2C3=CC=CC=C3N(C2=O)CC4=CC=CC=C4

Computed by PubChem (NCBI)