CAS 189035-69-6 is the registry number for (1S)-2'-(Dimethylamino)-[1,1'-binaphthalen]-2-ol 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-[2-(dimethylamino)naphthalen-1-yl]naphthalen-2-ol (CAS 189035-69-6) is a chemical compound with the molecular formula C22H19NO and a molecular weight of 313.4 g/mol. IUPAC name: 1-[2-(dimethylamino)naphthalen-1-yl]naphthalen-2-ol. InChIKey: HJTXMDPHWBQULQ-UHFFFAOYSA-N.
| Molecular formula | C22H19NO |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 1-[2-(dimethylamino)naphthalen-1-yl]naphthalen-2-ol |
| InChIKey | HJTXMDPHWBQULQ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)O |
Computed by PubChem (NCBI)