CAS 2148301-46-4 is the registry number for 4-(9,9-Dimethylacridin-10(9H)-yl)benzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-(9,9-dimethylacridin-10-yl)benzaldehyde (CAS 2148301-46-4) is a chemical compound with the molecular formula C22H19NO and a molecular weight of 313.4 g/mol. IUPAC name: 4-(9,9-dimethylacridin-10-yl)benzaldehyde. InChIKey: DNQSWKXOAWVZQA-UHFFFAOYSA-N.
| Molecular formula | C22H19NO |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 4-(9,9-dimethylacridin-10-yl)benzaldehyde |
| InChIKey | DNQSWKXOAWVZQA-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2N(C3=CC=CC=C31)C4=CC=C(C=C4)C=O)C |
Computed by PubChem (NCBI)