CAS 1210047-30-5 is the registry number for Ethyl 2-bromo-5-methylbenzoate, 95%. Offered by: AmBeed. Available pack sizes: 25g.
Ethyl 2-bromo-5-methylbenzoate (CAS 1210047-30-5) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: ethyl 2-bromo-5-methylbenzoate. InChIKey: NZBKEVGEFGDOBZ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | ethyl 2-bromo-5-methylbenzoate |
| InChIKey | NZBKEVGEFGDOBZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)C)Br |
Computed by PubChem (NCBI)