CAS 1210255-19-8 appears in our catalog under these names: 2,6-Difluorophenacylamine hydrochloride, 95%, 2-amino-1-(2,6-difluorophenyl)ethan-1-one hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-amino-1-(2,6-difluorophenyl)ethanone;hydrochloride (CAS 1210255-19-8) is a chemical compound with the molecular formula C8H8ClF2NO and a molecular weight of 207.60 g/mol. IUPAC name: 2-amino-1-(2,6-difluorophenyl)ethanone;hydrochloride. InChIKey: BTQHGMKVJQPOSM-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2NO |
|---|---|
| Molecular weight | 207.60 g/mol |
| IUPAC name | 2-amino-1-(2,6-difluorophenyl)ethanone;hydrochloride |
| InChIKey | BTQHGMKVJQPOSM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)CN)F.Cl |
Computed by PubChem (NCBI)