CAS 1247621-99-3 appears in our catalog under these names: 4-Chloro-2-(2,2-difluoroethoxy)aniline, 95%, 4-Chloro-2-(2,2-difluoroethoxy)aniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
4-chloro-2-(2,2-difluoroethoxy)aniline (CAS 1247621-99-3) is a chemical compound with the molecular formula C8H8ClF2NO and a molecular weight of 207.60 g/mol. IUPAC name: 4-chloro-2-(2,2-difluoroethoxy)aniline. InChIKey: GSQNKCGPPXQHQB-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2NO |
|---|---|
| Molecular weight | 207.60 g/mol |
| IUPAC name | 4-chloro-2-(2,2-difluoroethoxy)aniline |
| InChIKey | GSQNKCGPPXQHQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)OCC(F)F)N |
Computed by PubChem (NCBI)