CAS 1809595-09-2 is the registry number for 2-Amino-1-(2,5-difluorophenyl)ethanone hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2-amino-1-(2,5-difluorophenyl)ethanone;hydrochloride (CAS 1809595-09-2) is a chemical compound with the molecular formula C8H8ClF2NO and a molecular weight of 207.60 g/mol. IUPAC name: 2-amino-1-(2,5-difluorophenyl)ethanone;hydrochloride. InChIKey: SDJQNRMXSUUIGE-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2NO |
|---|---|
| Molecular weight | 207.60 g/mol |
| IUPAC name | 2-amino-1-(2,5-difluorophenyl)ethanone;hydrochloride |
| InChIKey | SDJQNRMXSUUIGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)CN)F.Cl |
Computed by PubChem (NCBI)