CAS 2167758-26-9 is the registry number for 2-Chloro-5-(2,2-difluoropropoxy)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-5-(2,2-difluoropropoxy)pyridine (CAS 2167758-26-9) is a chemical compound with the molecular formula C8H8ClF2NO and a molecular weight of 207.60 g/mol. IUPAC name: 2-chloro-5-(2,2-difluoropropoxy)pyridine. InChIKey: KJEDDDGGEGYLDU-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF2NO |
|---|---|
| Molecular weight | 207.60 g/mol |
| IUPAC name | 2-chloro-5-(2,2-difluoropropoxy)pyridine |
| InChIKey | KJEDDDGGEGYLDU-UHFFFAOYSA-N |
| SMILES | CC(COC1=CN=C(C=C1)Cl)(F)F |
Computed by PubChem (NCBI)