CAS 1210417-93-8 is the registry number for 3-Nitro-4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-3-nitropyridine (CAS 1210417-93-8) is a chemical compound with the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. IUPAC name: 4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-3-nitropyridine. InChIKey: XUBXFRRCSHATLZ-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O4 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 4-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-3-nitropyridine |
| InChIKey | XUBXFRRCSHATLZ-UHFFFAOYSA-N |
| SMILES | C1CC2(CC=C1C3=C(C=NC=C3)[N+](=O)[O-])OCCO2 |
Computed by PubChem (NCBI)