Products 1210419-18-3
CAS 1210419-18-3 is the registry number for 2-(2,6-Difluorophenyl)-3-fluoro-6-methylpyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2,6-difluorophenyl)-3-fluoro-6-methylpyridine (CAS 1210419-18-3) is a chemical compound with the molecular formula C12H8F3N and a molecular weight of 223.19 g/mol. IUPAC name: 2-(2,6-difluorophenyl)-3-fluoro-6-methylpyridine. InChIKey: GWJLTCGRKGCBMZ-UHFFFAOYSA-N.
| Molecular formula | C12H8F3N |
|---|---|
| Molecular weight | 223.19 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)-3-fluoro-6-methylpyridine |
| InChIKey | GWJLTCGRKGCBMZ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C=C1)F)C2=C(C=CC=C2F)F |
Computed by PubChem (NCBI)