CAS 426823-25-8 is the registry number for 3-(4-Trifluoromethylphenyl)pyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
3-[4-(trifluoromethyl)phenyl]pyridine (CAS 426823-25-8) is a chemical compound with the molecular formula C12H8F3N and a molecular weight of 223.19 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]pyridine. InChIKey: NLEVCXWLTHEKMV-UHFFFAOYSA-N.
| Molecular formula | C12H8F3N |
|---|---|
| Molecular weight | 223.19 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]pyridine |
| InChIKey | NLEVCXWLTHEKMV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)